C49H31N3 — CID 171598345
2-naphthalen-1-yl-4-(2,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-1-yl)-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine (PubChem CID 171598345) has the molecular formula C49H31N3 and a molecular weight of 670.86 g/mol. Its IUPAC name is 2-naphthalen-1-yl-4-(2,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-1-yl)-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-naphthalen-1-yl-4-(2,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-1-yl)-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 171598345 |
| Molecular Formula | C49H31N3 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | 2-naphthalen-1-yl-4-(2,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-1-yl)-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c([2H])c1c(-c3nc(-c4cccc(-c5ccc6cc(-c7ccccc7)ccc6c5)c4)nc(-c4cccc5ccccc45)n3)c([2H])c([2H])c([2H])c12 |
| InChI | InChI=1S/C49H31N3/c1-2-11-32(12-3-1)36-23-24-39-30-37(25-26-38(39)29-36)35-16-8-17-40(31-35)47-50-48(45-21-9-15-33-13-4-7-19-42(33)45)52-49(51-47)46-22-10-20-43-41-18-6-5-14-34(41)27-28-44(43)46/h1-31H/i5D,6D,10D,14D,18D,20D,22D,27D,28D |
| InChIKey | KQKMPPPYBFQHBH-NATOKFKESA-N |
| XLogP | 12.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|