C61H39N3 — CID 171439436
2-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-(5-naphthalen-1-ylnaphthalen-1-yl)-6-[3-(4-naphthalen-1-ylphenyl)phenyl]-1,3,5-triazine (PubChem CID 171439436) has the molecular formula C61H39N3 and a molecular weight of 821.05 g/mol. Its IUPAC name is 2-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-(5-naphthalen-1-ylnaphthalen-1-yl)-6-[3-(4-naphthalen-1-ylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-(5-naphthalen-1-ylnaphthalen-1-yl)-6-[3-(4-naphthalen-1-ylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 171439436 |
| Molecular Formula | C61H39N3 |
| Molecular Weight | 821.05 g/mol |
| Exact Mass | 820.36 |
| IUPAC Name | 2-[3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-(5-naphthalen-1-ylnaphthalen-1-yl)-6-[3-(4-naphthalen-1-ylphenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc(-c4nc(-c5cccc(-c6ccc(-c7cccc8ccccc78)cc6)c5)nc(-c5cccc6c(-c7cccc8ccccc78)cccc56)n4)c3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C61H39N3/c1-4-24-49-41(14-1)17-9-27-51(49)44-36-34-40(35-37-44)45-20-7-22-47(38-45)59-62-60(48-23-8-21-46(39-48)53-28-10-18-42-15-2-5-25-50(42)53)64-61(63-59)58-33-13-31-56-55(30-12-32-57(56)58)54-29-11-19-43-16-3-6-26-52(43)54/h1-39H/i2D,5D,10D,15D,18D,25D,28D |
| InChIKey | JAGAPHDKVGUPRZ-DVBXDKOPSA-N |
| XLogP | 16.15 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.05 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |