C45H29N3 — CID 169039958
2-[3-[6-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)naphthalen-2-yl]phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine (PubChem CID 169039958) has the molecular formula C45H29N3 and a molecular weight of 618.79 g/mol. Its IUPAC name is 2-[3-[6-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)naphthalen-2-yl]phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-[6-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)naphthalen-2-yl]phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 169039958 |
| Molecular Formula | C45H29N3 |
| Molecular Weight | 618.79 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 2-[3-[6-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)naphthalen-2-yl]phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4cc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccc8ccccc8c7)n6)c5)ccc4c3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C45H29N3/c1-2-12-32(13-3-1)43-46-44(48-45(47-43)40-25-20-30-10-4-5-14-33(30)28-40)39-17-8-16-34(29-39)35-21-22-37-27-38(24-23-36(37)26-35)42-19-9-15-31-11-6-7-18-41(31)42/h1-29H/i6D,7D,9D,11D,15D,18D,19D |
| InChIKey | MZRIGQNKEPLIAP-XOHSAPSESA-N |
| XLogP | 11.67 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.79 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |