C40H33N3Si — CID 176645479
[2-[3-[3-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]-trimethylsilane (PubChem CID 176645479) has the molecular formula C40H33N3Si and a molecular weight of 590.85 g/mol. Its IUPAC name is [2-[3-[3-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [2-[3-[3-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 176645479 |
| Molecular Formula | C40H33N3Si |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | [2-[3-[3-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]-trimethylsilane |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3nc(-c4ccccc4)nc(-c4cccc(-c5cccc(-c6ccccc6[Si](C)(C)C)c5)c4)n3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C40H33N3Si/c1-44(2,3)37-25-10-9-23-35(37)32-20-11-18-30(26-32)31-19-12-21-33(27-31)39-41-38(29-15-5-4-6-16-29)42-40(43-39)36-24-13-17-28-14-7-8-22-34(28)36/h4-27H,1-3H3/i7D,8D,13D,14D,17D,22D,24D |
| InChIKey | QFEJWELSKLJEKS-RBIIWGNISA-N |
| XLogP | 9.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|