C36H31N3Si — CID 176645624
[2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-trimethylsilane (PubChem CID 176645624) has the molecular formula C36H31N3Si and a molecular weight of 533.75 g/mol. Its IUPAC name is [2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 176645624 |
| Molecular Formula | C36H31N3Si |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | [2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccccc1-c1ccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C36H31N3Si/c1-40(2,3)33-20-11-10-19-32(33)27-23-21-26(22-24-27)30-17-12-18-31(25-30)36-38-34(28-13-6-4-7-14-28)37-35(39-36)29-15-8-5-9-16-29/h4-25H,1-3H3 |
| InChIKey | JIKULBMEEKPYAP-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|