C41H27N3 — CID 171469883
2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-[3-(4-naphthalen-1-ylphenyl)phenyl]-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 171469883) has the molecular formula C41H27N3 and a molecular weight of 573.76 g/mol. Its IUPAC name is 2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-[3-(4-naphthalen-1-ylphenyl)phenyl]-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-[3-(4-naphthalen-1-ylphenyl)phenyl]-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171469883 |
| Molecular Formula | C41H27N3 |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-[3-(4-naphthalen-1-ylphenyl)phenyl]-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3cccc(-c4ccc(-c5cccc6ccccc56)cc4)c3)nc(-c3c([2H])c([2H])c([2H])c4c([2H])c([2H])c([2H])c([2H])c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C41H27N3/c1-2-13-32(14-3-1)39-42-40(44-41(43-39)38-22-10-16-30-12-5-7-20-37(30)38)34-18-8-17-33(27-34)28-23-25-31(26-24-28)36-21-9-15-29-11-4-6-19-35(29)36/h1-27H/i1D,2D,3D,5D,7D,10D,12D,13D,14D,16D,20D,22D |
| InChIKey | SOZUVDJBZZETCU-HOUDEZQWSA-N |
| XLogP | 10.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |