C47H31N3 — CID 166022151
2-[5-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-4-phenyl-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine (PubChem CID 166022151) has the molecular formula C47H31N3 and a molecular weight of 642.82 g/mol. Its IUPAC name is 2-[5-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-4-phenyl-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[5-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-4-phenyl-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166022151 |
| Molecular Formula | C47H31N3 |
| Molecular Weight | 642.82 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 2-[5-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-4-phenyl-6-[3-(6-phenylnaphthalen-2-yl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c(-c4nc(-c5ccccc5)nc(-c5cccc(-c6ccc7cc(-c8ccccc8)ccc7c6)c5)n4)cccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C47H31N3/c1-4-13-32(14-5-1)36-25-26-39-30-37(27-28-38(39)29-36)35-19-10-20-40(31-35)46-48-45(34-17-8-3-9-18-34)49-47(50-46)44-24-12-22-42-41(21-11-23-43(42)44)33-15-6-2-7-16-33/h1-31H/i2D,6D,7D,15D,16D |
| InChIKey | IPXIDJSIZLWVPT-RGKSOHIZSA-N |
| XLogP | 12.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.82 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |