C53H35N3 — CID 169302456
2-[3-(4-naphthalen-1-ylphenyl)phenyl]-4-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 169302456) has the molecular formula C53H35N3 and a molecular weight of 718.91 g/mol. Its IUPAC name is 2-[3-(4-naphthalen-1-ylphenyl)phenyl]-4-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-(4-naphthalen-1-ylphenyl)phenyl]-4-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 169302456 |
| Molecular Formula | C53H35N3 |
| Molecular Weight | 718.91 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 2-[3-(4-naphthalen-1-ylphenyl)phenyl]-4-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3cc(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5cccc(-c6ccc(-c7cccc8ccccc78)cc6)c5)n4)ccc3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C53H35N3/c1-3-11-36(12-4-1)38-23-27-42(28-24-38)51-54-52(56-53(55-51)48-32-31-45-33-44(29-30-46(45)35-48)37-13-5-2-6-14-37)47-18-9-17-43(34-47)39-21-25-41(26-22-39)50-20-10-16-40-15-7-8-19-49(40)50/h1-35H/i2D,5D,6D,13D,14D |
| InChIKey | SHKJDHBWWDWUDW-LTTLSEBRSA-N |
| XLogP | 13.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.91 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |