C51H33N3 — CID 177278888
2-[3-(2,3,5,6,7,8-hexadeuterio-4-phenylnaphthalen-1-yl)phenyl]-4-naphthalen-2-yl-6-(5-phenylnaphthalen-1-yl)-1,3,5-triazine (PubChem CID 177278888) has the molecular formula C51H33N3 and a molecular weight of 693.88 g/mol. Its IUPAC name is 2-[3-(2,3,5,6,7,8-hexadeuterio-4-phenylnaphthalen-1-yl)phenyl]-4-naphthalen-2-yl-6-(5-phenylnaphthalen-1-yl)-1,3,5-triazine.
| Compound Name | 2-[3-(2,3,5,6,7,8-hexadeuterio-4-phenylnaphthalen-1-yl)phenyl]-4-naphthalen-2-yl-6-(5-phenylnaphthalen-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 177278888 |
| Molecular Formula | C51H33N3 |
| Molecular Weight | 693.88 g/mol |
| Exact Mass | 693.31 |
| IUPAC Name | 2-[3-(2,3,5,6,7,8-hexadeuterio-4-phenylnaphthalen-1-yl)phenyl]-4-naphthalen-2-yl-6-(5-phenylnaphthalen-1-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc(-c4nc(-c5ccc6ccccc6c5)nc(-c5cccc6c(-c7ccccc7)cccc56)n4)c3)c([2H])c([2H])c(-c3ccccc3)c2c1[2H] |
| InChI | InChI=1S/C51H33N3/c1-3-15-35(16-4-1)41-24-12-26-47-46(41)25-13-27-48(47)51-53-49(52-50(54-51)40-29-28-34-14-7-8-19-37(34)32-40)39-21-11-20-38(33-39)43-31-30-42(36-17-5-2-6-18-36)44-22-9-10-23-45(43)44/h1-33H/i9D,10D,22D,23D,30D,31D |
| InChIKey | LUVSUAANVKBCLK-SMQUZTQDSA-N |
| XLogP | 13.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.88 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |