C42H28N2 — CID 171469871
2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-[3-(4-naphthalen-1-ylphenyl)phenyl]-6-phenylpyrimidine (PubChem CID 171469871) has the molecular formula C42H28N2 and a molecular weight of 567.74 g/mol. Its IUPAC name is 2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-[3-(4-naphthalen-1-ylphenyl)phenyl]-6-phenylpyrimidine.
| Compound Name | 2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-[3-(4-naphthalen-1-ylphenyl)phenyl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 171469871 |
| Molecular Formula | C42H28N2 |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 2-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-4-[3-(4-naphthalen-1-ylphenyl)phenyl]-6-phenylpyrimidine |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3nc(-c4ccccc4)cc(-c4cccc(-c5ccc(-c6cccc7ccccc67)cc5)c4)n3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C42H28N2/c1-2-13-33(14-3-1)40-28-41(44-42(43-40)39-22-10-16-31-12-5-7-20-38(31)39)35-18-8-17-34(27-35)29-23-25-32(26-24-29)37-21-9-15-30-11-4-6-19-36(30)37/h1-28H/i5D,7D,10D,12D,16D,20D,22D |
| InChIKey | AUTMFOOORXLZNA-CEDJQCPQSA-N |
| XLogP | 11.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |