C57H35N3S — CID 171731289
2-[3-(6-dibenzothiophen-1-ylnaphthalen-2-yl)phenyl]-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-(3-naphthalen-1-ylphenyl)-1,3,5-triazine (PubChem CID 171731289) has the molecular formula C57H35N3S and a molecular weight of 801.04 g/mol. Its IUPAC name is 2-[3-(6-dibenzothiophen-1-ylnaphthalen-2-yl)phenyl]-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-(3-naphthalen-1-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-(6-dibenzothiophen-1-ylnaphthalen-2-yl)phenyl]-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-(3-naphthalen-1-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171731289 |
| Molecular Formula | C57H35N3S |
| Molecular Weight | 801.04 g/mol |
| Exact Mass | 800.30 |
| IUPAC Name | 2-[3-(6-dibenzothiophen-1-ylnaphthalen-2-yl)phenyl]-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-(3-naphthalen-1-ylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3nc(-c4cccc(-c5ccc6cc(-c7cccc8sc9ccccc9c78)ccc6c5)c4)nc(-c4cccc(-c5cccc6ccccc56)c4)n3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C57H35N3S/c1-3-20-46-36(12-1)14-9-23-48(46)42-17-8-19-45(35-42)56-58-55(59-57(60-56)50-25-10-15-37-13-2-4-21-47(37)50)44-18-7-16-38(34-44)39-28-29-41-33-43(31-30-40(41)32-39)49-24-11-27-53-54(49)51-22-5-6-26-52(51)61-53/h1-35H/i2D,4D,10D,13D,15D,21D,25D |
| InChIKey | BCBVRMFBTJYLHY-BHIUXZKZSA-N |
| XLogP | 15.70 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.04 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |