C51H31N3O — CID 170926971
2-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-naphthalen-2-yl-6-(4,6,7,8-tetradeuterio-2-naphthalen-2-yldibenzofuran-1-yl)-1,3,5-triazine (PubChem CID 170926971) has the molecular formula C51H31N3O and a molecular weight of 712.90 g/mol. Its IUPAC name is 2-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-naphthalen-2-yl-6-(4,6,7,8-tetradeuterio-2-naphthalen-2-yldibenzofuran-1-yl)-1,3,5-triazine.
| Compound Name | 2-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-naphthalen-2-yl-6-(4,6,7,8-tetradeuterio-2-naphthalen-2-yldibenzofuran-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170926971 |
| Molecular Formula | C51H31N3O |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 712.32 |
| IUPAC Name | 2-[4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)phenyl]-4-naphthalen-2-yl-6-(4,6,7,8-tetradeuterio-2-naphthalen-2-yldibenzofuran-1-yl)-1,3,5-triazine |
| SMILES | [2H]c1cc2c(oc3c([2H])cc(-c4ccc5ccccc5c4)c(-c4nc(-c5ccc(-c6c([2H])c([2H])c([2H])c7c([2H])c([2H])c([2H])c([2H])c67)cc5)nc(-c5ccc6ccccc6c5)n4)c32)c([2H])c1[2H] |
| InChI | InChI=1S/C51H31N3O/c1-3-13-37-30-39(26-20-32(37)10-1)43-28-29-46-47(44-17-7-8-19-45(44)55-46)48(43)51-53-49(52-50(54-51)40-27-21-33-11-2-4-14-38(33)31-40)36-24-22-35(23-25-36)42-18-9-15-34-12-5-6-16-41(34)42/h1-31H/i5D,6D,7D,8D,9D,12D,15D,16D,18D,19D,29D |
| InChIKey | YTLDANWNSRNRJH-MHCBUKEZSA-N |
| XLogP | 13.57 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |