C39H25N3 — CID 164970097
2,4-dinaphthalen-2-yl-6-[7-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-1,3,5-triazine (PubChem CID 164970097) has the molecular formula C39H25N3 and a molecular weight of 540.68 g/mol. Its IUPAC name is 2,4-dinaphthalen-2-yl-6-[7-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-1,3,5-triazine.
| Compound Name | 2,4-dinaphthalen-2-yl-6-[7-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 164970097 |
| Molecular Formula | C39H25N3 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 2,4-dinaphthalen-2-yl-6-[7-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-2-yl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3ccc(-c4nc(-c5ccc6ccccc6c5)nc(-c5ccc6ccccc6c5)n4)cc3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C39H25N3/c1-2-8-26(9-3-1)32-18-14-29-17-21-35(25-36(29)24-32)39-41-37(33-19-15-27-10-4-6-12-30(27)22-33)40-38(42-39)34-20-16-28-11-5-7-13-31(28)23-34/h1-25H/i1D,2D,3D,8D,9D |
| InChIKey | ASHJKQKLXMYLDT-NWCULCSXSA-N |
| XLogP | 10.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |