C25H16ClN3 — CID 171731211
2-chloro-4-naphthalen-2-yl-6-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine (PubChem CID 171731211) has the molecular formula C25H16ClN3 and a molecular weight of 398.91 g/mol. Its IUPAC name is 2-chloro-4-naphthalen-2-yl-6-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-chloro-4-naphthalen-2-yl-6-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 171731211 |
| Molecular Formula | C25H16ClN3 |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-chloro-4-naphthalen-2-yl-6-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3nc(Cl)nc(-c4ccc5ccccc5c4)n3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C25H16ClN3/c26-25-28-23(20-13-10-19(11-14-20)17-6-2-1-3-7-17)27-24(29-25)22-15-12-18-8-4-5-9-21(18)16-22/h1-16H/i1D,2D,3D,6D,7D |
| InChIKey | UXGJAFKZWBEOKE-FSTBWYLISA-N |
| XLogP | 6.68 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |