C25H16ClN3 — CID 176767502
2-chloro-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-1,3,5-triazine (PubChem CID 176767502) has the molecular formula C25H16ClN3 and a molecular weight of 403.94 g/mol. Its IUPAC name is 2-chloro-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-1,3,5-triazine.
| Compound Name | 2-chloro-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176767502 |
| Molecular Formula | C25H16ClN3 |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-chloro-4-(2,3,4,5,6-pentadeuteriophenyl)-6-[6-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(-c4nc(Cl)nc(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])n4)cccc3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C25H16ClN3/c26-25-28-23(18-10-5-2-6-11-18)27-24(29-25)22-13-7-12-20-16-19(14-15-21(20)22)17-8-3-1-4-9-17/h1-16H/i1D,2D,3D,4D,5D,6D,8D,9D,10D,11D |
| InChIKey | YNWVQBOLFGQIPF-RYDBCNKQSA-N |
| XLogP | 6.68 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |