C51H33N3 — CID 176831507
2-(2-phenylphenyl)-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-6-(3-triphenylen-2-ylphenyl)-1,3,5-triazine (PubChem CID 176831507) has the molecular formula C51H33N3 and a molecular weight of 696.90 g/mol. Its IUPAC name is 2-(2-phenylphenyl)-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-6-(3-triphenylen-2-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-(2-phenylphenyl)-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-6-(3-triphenylen-2-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176831507 |
| Molecular Formula | C51H33N3 |
| Molecular Weight | 696.90 g/mol |
| Exact Mass | 696.32 |
| IUPAC Name | 2-(2-phenylphenyl)-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-6-(3-triphenylen-2-ylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(-c3nc(-c4cccc(-c5ccc6c7ccccc7c7ccccc7c6c5)c4)nc(-c4ccccc4-c4ccccc4)n3)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C51H33N3/c1-3-14-34(15-4-1)35-26-28-37(29-27-35)49-52-50(54-51(53-49)47-25-12-7-20-41(47)36-16-5-2-6-17-36)40-19-13-18-38(32-40)39-30-31-46-44-23-9-8-21-42(44)43-22-10-11-24-45(43)48(46)33-39/h1-33H/i1D,3D,4D,14D,15D,26D,27D,28D,29D |
| InChIKey | IAMVRBYUDXPUFV-PPMQPJCJSA-N |
| XLogP | 13.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.90 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|