C51H33N3S — CID 155762425
2-[8-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]dibenzothiophen-1-yl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 155762425) has the molecular formula C51H33N3S and a molecular weight of 724.94 g/mol. Its IUPAC name is 2-[8-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]dibenzothiophen-1-yl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[8-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]dibenzothiophen-1-yl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 155762425 |
| Molecular Formula | C51H33N3S |
| Molecular Weight | 724.94 g/mol |
| Exact Mass | 724.27 |
| IUPAC Name | 2-[8-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]dibenzothiophen-1-yl]-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3ccc(-c4ccc5sc6cccc(-c7nc(-c8ccccc8)nc(-c8cccc(-c9ccccc9)c8)n7)c6c5c4)cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C51H33N3S/c1-4-12-34(13-5-1)36-22-24-37(25-23-36)38-26-28-39(29-27-38)42-30-31-46-45(33-42)48-44(20-11-21-47(48)55-46)51-53-49(40-16-8-3-9-17-40)52-50(54-51)43-19-10-18-41(32-43)35-14-6-2-7-15-35/h1-33H/i1D,4D,5D,12D,13D |
| InChIKey | QUSNLSDWLKXQTR-RJUHWWGZSA-N |
| XLogP | 13.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.94 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |