C45H27N3S2 — CID 171050676
2-[6,8-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-1-yl]-4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazine (PubChem CID 171050676) has the molecular formula C45H27N3S2 and a molecular weight of 683.93 g/mol. Its IUPAC name is 2-[6,8-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-1-yl]-4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[6,8-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-1-yl]-4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 171050676 |
| Molecular Formula | C45H27N3S2 |
| Molecular Weight | 683.93 g/mol |
| Exact Mass | 683.23 |
| IUPAC Name | 2-[6,8-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-1-yl]-4-dibenzothiophen-2-yl-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3sc4cccc(-c5nc(-c6ccccc6)nc(-c6ccc7sc8ccccc8c7c6)n5)c4c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H27N3S2/c1-4-13-28(14-5-1)32-26-35(29-15-6-2-7-16-29)42-37(27-32)41-34(20-12-22-40(41)50-42)45-47-43(30-17-8-3-9-18-30)46-44(48-45)31-23-24-39-36(25-31)33-19-10-11-21-38(33)49-39/h1-27H/i1D,2D,4D,5D,6D,7D,13D,14D,15D,16D |
| InChIKey | UOJBPKVQGPAQNH-QBFVQXFVSA-N |
| XLogP | 12.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.93 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |