C45H29N3S — CID 164942712
2-(4-dibenzothiophen-4-ylphenyl)-4-(2-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine (PubChem CID 164942712) has the molecular formula C45H29N3S and a molecular weight of 652.87 g/mol. Its IUPAC name is 2-(4-dibenzothiophen-4-ylphenyl)-4-(2-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(4-dibenzothiophen-4-ylphenyl)-4-(2-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 164942712 |
| Molecular Formula | C45H29N3S |
| Molecular Weight | 652.87 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | 2-(4-dibenzothiophen-4-ylphenyl)-4-(2-phenylphenyl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(-c3nc(-c4ccc(-c5cccc6c5sc5ccccc56)cc4)nc(-c4ccccc4-c4ccccc4)n3)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C45H29N3S/c1-3-12-30(13-4-1)31-22-26-34(27-23-31)43-46-44(48-45(47-43)40-18-8-7-16-36(40)32-14-5-2-6-15-32)35-28-24-33(25-29-35)37-19-11-20-39-38-17-9-10-21-41(38)49-42(37)39/h1-29H/i1D,3D,4D,12D,13D,22D,23D,26D,27D |
| InChIKey | MIUQACJHTDOFAO-VYOFTLJGSA-N |
| XLogP | 12.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.87 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |