C45H27N3S — CID 168770379
2-(2,3,4,5,6-pentadeuteriophenyl)-4-phenyl-6-(6-triphenylen-2-yldibenzothiophen-4-yl)-1,3,5-triazine (PubChem CID 168770379) has the molecular formula C45H27N3S and a molecular weight of 646.83 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentadeuteriophenyl)-4-phenyl-6-(6-triphenylen-2-yldibenzothiophen-4-yl)-1,3,5-triazine.
| Compound Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-4-phenyl-6-(6-triphenylen-2-yldibenzothiophen-4-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168770379 |
| Molecular Formula | C45H27N3S |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-4-phenyl-6-(6-triphenylen-2-yldibenzothiophen-4-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3cccc4c3sc3c(-c5ccc6c7ccccc7c7ccccc7c6c5)cccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H27N3S/c1-3-13-28(14-4-1)43-46-44(29-15-5-2-6-16-29)48-45(47-43)39-24-12-23-38-37-22-11-21-31(41(37)49-42(38)39)30-25-26-36-34-19-8-7-17-32(34)33-18-9-10-20-35(33)40(36)27-30/h1-27H/i1D,3D,4D,13D,14D |
| InChIKey | PPQIKNFBQBZRRX-CULCNESPSA-N |
| XLogP | 12.37 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|