C49H29N3OS — CID 153494941
2-dibenzofuran-3-yl-4-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-4-yl]naphthalen-1-yl]-6-phenyl-1,3,5-triazine (PubChem CID 153494941) has the molecular formula C49H29N3OS and a molecular weight of 712.89 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-4-yl]naphthalen-1-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-4-yl]naphthalen-1-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 153494941 |
| Molecular Formula | C49H29N3OS |
| Molecular Weight | 712.89 g/mol |
| Exact Mass | 712.23 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-[3-[6-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-4-yl]naphthalen-1-yl]-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2sc2c(-c4cc(-c5nc(-c6ccccc6)nc(-c6ccc7c(c6)oc6ccccc67)n5)c5ccccc5c4)cccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C49H29N3OS/c1-3-13-30(14-4-1)36-20-11-22-40-41-23-12-21-37(46(41)54-45(36)40)34-27-32-17-7-8-18-35(32)42(28-34)49-51-47(31-15-5-2-6-16-31)50-48(52-49)33-25-26-39-38-19-9-10-24-43(38)53-44(39)29-33/h1-29H/i1D,3D,4D,13D,14D |
| InChIKey | DFNCRPWCFJHXGW-CULCNESPSA-N |
| XLogP | 13.63 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.89 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |