C31H20ClN3 — CID 176627431
2-chloro-4-[4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-6-(2-phenylphenyl)-1,3,5-triazine (PubChem CID 176627431) has the molecular formula C31H20ClN3 and a molecular weight of 475.01 g/mol. Its IUPAC name is 2-chloro-4-[4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-6-(2-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-[4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-6-(2-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176627431 |
| Molecular Formula | C31H20ClN3 |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-chloro-4-[4-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-6-(2-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3nc(Cl)nc(-c4ccccc4-c4ccccc4)n3)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C31H20ClN3/c32-31-34-29(27-18-10-7-15-23(27)21-11-3-1-4-12-21)33-30(35-31)28-20-19-24(22-13-5-2-6-14-22)25-16-8-9-17-26(25)28/h1-20H/i2D,5D,6D,13D,14D |
| InChIKey | YLVFACWZCQOQCO-LTTLSEBRSA-N |
| XLogP | 8.35 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |