C19H12ClN3 — CID 170691103
2-chloro-4-naphthalen-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 170691103) has the molecular formula C19H12ClN3 and a molecular weight of 322.81 g/mol. Its IUPAC name is 2-chloro-4-naphthalen-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-naphthalen-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170691103 |
| Molecular Formula | C19H12ClN3 |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-chloro-4-naphthalen-1-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(Cl)nc(-c3cccc4ccccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C19H12ClN3/c20-19-22-17(14-8-2-1-3-9-14)21-18(23-19)16-12-6-10-13-7-4-5-11-15(13)16/h1-12H/i1D,2D,3D,8D,9D |
| InChIKey | BCJVAUGUKQWPRH-NWCULCSXSA-N |
| XLogP | 5.01 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |