C21H25N — CID 144615927
N-cyclohexa-1,5-dien-1-yl-4-methyl-N-phenylaniline;ethane (PubChem CID 144615927) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-4-methyl-N-phenylaniline;ethane.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-4-methyl-N-phenylaniline;ethane |
|---|---|
| PubChem CID | 144615927 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-4-methyl-N-phenylaniline;ethane |
| SMILES | CC.Cc1ccc(N(C2=CCCC=C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N.C2H6/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;1-2/h2,4-6,8-15H,3,7H2,1H3;1-2H3 |
| InChIKey | HDGBCYMKAUDENF-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |