C27H32N2O — CID 69028236
1-(3,3-diphenylpropyl)-3-(4-methylphenyl)-1-(2-methylpropyl)urea (PubChem CID 69028236) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-(4-methylphenyl)-1-(2-methylpropyl)urea.
| Compound Name | 1-(3,3-diphenylpropyl)-3-(4-methylphenyl)-1-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 69028236 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-(4-methylphenyl)-1-(2-methylpropyl)urea |
| SMILES | Cc1ccc(NC(=O)N(CCC(c2ccccc2)c2ccccc2)CC(C)C)cc1 |
| InChI | InChI=1S/C27H32N2O/c1-21(2)20-29(27(30)28-25-16-14-22(3)15-17-25)19-18-26(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-17,21,26H,18-20H2,1-3H3,(H,28,30) |
| InChIKey | RGIKGNMUHRFHEN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |