C32H38N4O3 — CID 172714176
4-[2-[[3,3-diphenylpropyl-[(4-methylphenyl)carbamoyl]amino]methyl]prop-2-enyl]piperazine-1-carboxylic acid (PubChem CID 172714176) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 4-[2-[[3,3-diphenylpropyl-[(4-methylphenyl)carbamoyl]amino]methyl]prop-2-enyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-[[3,3-diphenylpropyl-[(4-methylphenyl)carbamoyl]amino]methyl]prop-2-enyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 172714176 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 4-[2-[[3,3-diphenylpropyl-[(4-methylphenyl)carbamoyl]amino]methyl]prop-2-enyl]piperazine-1-carboxylic acid |
| SMILES | C=C(CN1CCN(C(=O)O)CC1)CN(CCC(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C32H38N4O3/c1-25-13-15-29(16-14-25)33-31(37)36(24-26(2)23-34-19-21-35(22-20-34)32(38)39)18-17-30(27-9-5-3-6-10-27)28-11-7-4-8-12-28/h3-16,30H,2,17-24H2,1H3,(H,33,37)(H,38,39) |
| InChIKey | FQIADQBFNNUZRW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|