C30H36N4O2 — CID 10277770
1-(2,2-diphenylethyl)-3-(3-methoxyphenyl)-1-[2-(piperazin-1-ylmethyl)prop-2-enyl]urea (PubChem CID 10277770) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-3-(3-methoxyphenyl)-1-[2-(piperazin-1-ylmethyl)prop-2-enyl]urea.
| Compound Name | 1-(2,2-diphenylethyl)-3-(3-methoxyphenyl)-1-[2-(piperazin-1-ylmethyl)prop-2-enyl]urea |
|---|---|
| PubChem CID | 10277770 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 1-(2,2-diphenylethyl)-3-(3-methoxyphenyl)-1-[2-(piperazin-1-ylmethyl)prop-2-enyl]urea |
| SMILES | C=C(CN1CCNCC1)CN(CC(c1ccccc1)c1ccccc1)C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C30H36N4O2/c1-24(21-33-18-16-31-17-19-33)22-34(30(35)32-27-14-9-15-28(20-27)36-2)23-29(25-10-5-3-6-11-25)26-12-7-4-8-13-26/h3-15,20,29,31H,1,16-19,21-23H2,2H3,(H,32,35) |
| InChIKey | WFWHCMUBCNKSBW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|