C31H37ClN4O — CID 10208034
3-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)-1-[2-(piperazin-1-ylmethyl)prop-2-enyl]urea (PubChem CID 10208034) has the molecular formula C31H37ClN4O and a molecular weight of 517.12 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)-1-[2-(piperazin-1-ylmethyl)prop-2-enyl]urea.
| Compound Name | 3-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)-1-[2-(piperazin-1-ylmethyl)prop-2-enyl]urea |
|---|---|
| PubChem CID | 10208034 |
| Molecular Formula | C31H37ClN4O |
| Molecular Weight | 517.12 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)-1-[2-(piperazin-1-ylmethyl)prop-2-enyl]urea |
| SMILES | C=C(CN1CCNCC1)CN(CCC(c1ccccc1)c1ccccc1)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C31H37ClN4O/c1-25(23-35-20-17-33-18-21-35)24-36(31(37)34-22-28-14-8-9-15-30(28)32)19-16-29(26-10-4-2-5-11-26)27-12-6-3-7-13-27/h2-15,29,33H,1,16-24H2,(H,34,37) |
| InChIKey | XSMYEIIVIXCTTF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.12 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|