C14H18ClN3O2 — CID 43327502
N-[(2-chlorophenyl)methyl]-2-(1,4-diazepan-1-yl)-2-oxoacetamide (PubChem CID 43327502) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(1,4-diazepan-1-yl)-2-oxoacetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(1,4-diazepan-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 43327502 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(1,4-diazepan-1-yl)-2-oxoacetamide |
| SMILES | O=C(NCc1ccccc1Cl)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C14H18ClN3O2/c15-12-5-2-1-4-11(12)10-17-13(19)14(20)18-8-3-6-16-7-9-18/h1-2,4-5,16H,3,6-10H2,(H,17,19) |
| InChIKey | AAOYVPGADSZQGB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|