C14H20N4O2 — CID 62307548
2-(1,4-diazepan-1-yl)-N-[(6-methyl-2-pyridinyl)methyl]-2-oxoacetamide (PubChem CID 62307548) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-[(6-methyl-2-pyridinyl)methyl]-2-oxoacetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-[(6-methyl-2-pyridinyl)methyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 62307548 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-[(6-methyl-2-pyridinyl)methyl]-2-oxoacetamide |
| SMILES | Cc1cccc(CNC(=O)C(=O)N2CCCNCC2)n1 |
| InChI | InChI=1S/C14H20N4O2/c1-11-4-2-5-12(17-11)10-16-13(19)14(20)18-8-3-6-15-7-9-18/h2,4-5,15H,3,6-10H2,1H3,(H,16,19) |
| InChIKey | CUBFOHPIXTWODO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|