C14H19N3O2 — CID 43327555
2-(1,4-diazepan-1-yl)-N-(4-methylphenyl)-2-oxoacetamide (PubChem CID 43327555) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(4-methylphenyl)-2-oxoacetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(4-methylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 43327555 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(4-methylphenyl)-2-oxoacetamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N2CCCNCC2)cc1 |
| InChI | InChI=1S/C14H19N3O2/c1-11-3-5-12(6-4-11)16-13(18)14(19)17-9-2-7-15-8-10-17/h3-6,15H,2,7-10H2,1H3,(H,16,18) |
| InChIKey | HFISNTKORBGJQA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|