C12H19N5O2 — CID 43543988
2-(1,4-diazepan-1-yl)-N-(1-ethylpyrazol-4-yl)-2-oxoacetamide (PubChem CID 43543988) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(1-ethylpyrazol-4-yl)-2-oxoacetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(1-ethylpyrazol-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 43543988 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(1-ethylpyrazol-4-yl)-2-oxoacetamide |
| SMILES | CCn1cc(NC(=O)C(=O)N2CCCNCC2)cn1 |
| InChI | InChI=1S/C12H19N5O2/c1-2-17-9-10(8-14-17)15-11(18)12(19)16-6-3-4-13-5-7-16/h8-9,13H,2-7H2,1H3,(H,15,18) |
| InChIKey | YMGLQFSAPBRHOJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|