C13H15Cl2N3O2 — CID 23555753
N-(3,5-dichloro-4-methylphenyl)-2-oxo-2-piperazin-1-ylacetamide (PubChem CID 23555753) has the molecular formula C13H15Cl2N3O2 and a molecular weight of 316.19 g/mol. Its IUPAC name is N-(3,5-dichloro-4-methylphenyl)-2-oxo-2-piperazin-1-ylacetamide.
| Compound Name | N-(3,5-dichloro-4-methylphenyl)-2-oxo-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 23555753 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-(3,5-dichloro-4-methylphenyl)-2-oxo-2-piperazin-1-ylacetamide |
| SMILES | Cc1c(Cl)cc(NC(=O)C(=O)N2CCNCC2)cc1Cl |
| InChI | InChI=1S/C13H15Cl2N3O2/c1-8-10(14)6-9(7-11(8)15)17-12(19)13(20)18-4-2-16-3-5-18/h6-7,16H,2-5H2,1H3,(H,17,19) |
| InChIKey | XWCAYJCEJURWEZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|