C13H16FN3O3 — CID 43381036
N-(3-fluoro-4-methoxyphenyl)-2-oxo-2-piperazin-1-ylacetamide (PubChem CID 43381036) has the molecular formula C13H16FN3O3 and a molecular weight of 281.29 g/mol. Its IUPAC name is N-(3-fluoro-4-methoxyphenyl)-2-oxo-2-piperazin-1-ylacetamide.
| Compound Name | N-(3-fluoro-4-methoxyphenyl)-2-oxo-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 43381036 |
| Molecular Formula | C13H16FN3O3 |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(3-fluoro-4-methoxyphenyl)-2-oxo-2-piperazin-1-ylacetamide |
| SMILES | COc1ccc(NC(=O)C(=O)N2CCNCC2)cc1F |
| InChI | InChI=1S/C13H16FN3O3/c1-20-11-3-2-9(8-10(11)14)16-12(18)13(19)17-6-4-15-5-7-17/h2-3,8,15H,4-7H2,1H3,(H,16,18) |
| InChIKey | ZRXJMWNWMQGKOQ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|