C16H21ClN2O3 — CID 108501193
N-(3-chloro-4-methoxyphenyl)-2-(3,5-dimethylpiperidin-1-yl)-2-oxoacetamide (PubChem CID 108501193) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-(3,5-dimethylpiperidin-1-yl)-2-oxoacetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-(3,5-dimethylpiperidin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108501193 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-(3,5-dimethylpiperidin-1-yl)-2-oxoacetamide |
| SMILES | COc1ccc(NC(=O)C(=O)N2CC(C)CC(C)C2)cc1Cl |
| InChI | InChI=1S/C16H21ClN2O3/c1-10-6-11(2)9-19(8-10)16(21)15(20)18-12-4-5-14(22-3)13(17)7-12/h4-5,7,10-11H,6,8-9H2,1-3H3,(H,18,20) |
| InChIKey | KZJHKPQBLVLAFO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|