C21H20FN3O5 — CID 58350844
2-[4-(3-fluoro-4-methoxyphenyl)piperazin-1-yl]-2-oxo-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide (PubChem CID 58350844) has the molecular formula C21H20FN3O5 and a molecular weight of 413.41 g/mol. Its IUPAC name is 2-[4-(3-fluoro-4-methoxyphenyl)piperazin-1-yl]-2-oxo-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide.
| Compound Name | 2-[4-(3-fluoro-4-methoxyphenyl)piperazin-1-yl]-2-oxo-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide |
|---|---|
| PubChem CID | 58350844 |
| Molecular Formula | C21H20FN3O5 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-[4-(3-fluoro-4-methoxyphenyl)piperazin-1-yl]-2-oxo-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide |
| SMILES | COc1ccc(N2CCN(C(=O)C(=O)Nc3ccc4c(c3)OC(=O)C4)CC2)cc1F |
| InChI | InChI=1S/C21H20FN3O5/c1-29-17-5-4-15(12-16(17)22)24-6-8-25(9-7-24)21(28)20(27)23-14-3-2-13-10-19(26)30-18(13)11-14/h2-5,11-12H,6-10H2,1H3,(H,23,27) |
| InChIKey | WNLOFICMEWTJQD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|