C21H21ClFN3O3 — CID 58467666
2-[(2R)-4-(4-chloro-3-fluorophenyl)-2-methylpiperazin-1-yl]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide (PubChem CID 58467666) has the molecular formula C21H21ClFN3O3 and a molecular weight of 417.87 g/mol. Its IUPAC name is 2-[(2R)-4-(4-chloro-3-fluorophenyl)-2-methylpiperazin-1-yl]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide.
| Compound Name | 2-[(2R)-4-(4-chloro-3-fluorophenyl)-2-methylpiperazin-1-yl]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide |
|---|---|
| PubChem CID | 58467666 |
| Molecular Formula | C21H21ClFN3O3 |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[(2R)-4-(4-chloro-3-fluorophenyl)-2-methylpiperazin-1-yl]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide |
| SMILES | C[C@@H]1CN(c2ccc(Cl)c(F)c2)CCN1CC(=O)Nc1ccc2c(c1)OC(=O)C2 |
| InChI | InChI=1S/C21H21ClFN3O3/c1-13-11-26(16-4-5-17(22)18(23)10-16)7-6-25(13)12-20(27)24-15-3-2-14-8-21(28)29-19(14)9-15/h2-5,9-10,13H,6-8,11-12H2,1H3,(H,24,27)/t13-/m1/s1 |
| InChIKey | QJBSVSXILAZEAO-CYBMUJFWSA-N |
| XLogP | 3.09 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|