C21H22F2N4O4 — CID 58467508
2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(2-oxo-3H-furo[3,2-b]pyridin-6-yl)acetamide (PubChem CID 58467508) has the molecular formula C21H22F2N4O4 and a molecular weight of 432.43 g/mol. Its IUPAC name is 2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(2-oxo-3H-furo[3,2-b]pyridin-6-yl)acetamide.
| Compound Name | 2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(2-oxo-3H-furo[3,2-b]pyridin-6-yl)acetamide |
|---|---|
| PubChem CID | 58467508 |
| Molecular Formula | C21H22F2N4O4 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(2-oxo-3H-furo[3,2-b]pyridin-6-yl)acetamide |
| SMILES | COc1c(F)cc(N2CCN(CC(=O)Nc3cnc4c(c3)OC(=O)C4)[C@H](C)C2)cc1F |
| InChI | InChI=1S/C21H22F2N4O4/c1-12-10-27(14-6-15(22)21(30-2)16(23)7-14)4-3-26(12)11-19(28)25-13-5-18-17(24-9-13)8-20(29)31-18/h5-7,9,12H,3-4,8,10-11H2,1-2H3,(H,25,28)/t12-/m1/s1 |
| InChIKey | WPUIHQKEVCCJJC-GFCCVEGCSA-N |
| XLogP | 1.98 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|