C23H26F2N4O3 — CID 58467672
2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(1-methyl-2-oxo-3H-indol-6-yl)acetamide (PubChem CID 58467672) has the molecular formula C23H26F2N4O3 and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(1-methyl-2-oxo-3H-indol-6-yl)acetamide.
| Compound Name | 2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(1-methyl-2-oxo-3H-indol-6-yl)acetamide |
|---|---|
| PubChem CID | 58467672 |
| Molecular Formula | C23H26F2N4O3 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-[(2R)-4-(3,5-difluoro-4-methoxyphenyl)-2-methylpiperazin-1-yl]-N-(1-methyl-2-oxo-3H-indol-6-yl)acetamide |
| SMILES | COc1c(F)cc(N2CCN(CC(=O)Nc3ccc4c(c3)N(C)C(=O)C4)[C@H](C)C2)cc1F |
| InChI | InChI=1S/C23H26F2N4O3/c1-14-12-29(17-10-18(24)23(32-3)19(25)11-17)7-6-28(14)13-21(30)26-16-5-4-15-8-22(31)27(2)20(15)9-16/h4-5,9-11,14H,6-8,12-13H2,1-3H3,(H,26,30)/t14-/m1/s1 |
| InChIKey | FKMTWPVDKBKBIS-CQSZACIVSA-N |
| XLogP | 2.64 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|