C23H24ClF2N3O2 — CID 58467599
2-[(3R)-4-(4-chloro-3,5-difluorophenyl)-3-methylpiperazin-1-yl]-N-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)acetamide (PubChem CID 58467599) has the molecular formula C23H24ClF2N3O2 and a molecular weight of 447.91 g/mol. Its IUPAC name is 2-[(3R)-4-(4-chloro-3,5-difluorophenyl)-3-methylpiperazin-1-yl]-N-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)acetamide.
| Compound Name | 2-[(3R)-4-(4-chloro-3,5-difluorophenyl)-3-methylpiperazin-1-yl]-N-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 58467599 |
| Molecular Formula | C23H24ClF2N3O2 |
| Molecular Weight | 447.91 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-[(3R)-4-(4-chloro-3,5-difluorophenyl)-3-methylpiperazin-1-yl]-N-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)acetamide |
| SMILES | C[C@@H]1CN(CC(=O)Nc2ccc3c(c2)CCC(=O)C3)CCN1c1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C23H24ClF2N3O2/c1-14-12-28(6-7-29(14)18-10-20(25)23(24)21(26)11-18)13-22(31)27-17-4-2-16-9-19(30)5-3-15(16)8-17/h2,4,8,10-11,14H,3,5-7,9,12-13H2,1H3,(H,27,31)/t14-/m1/s1 |
| InChIKey | RXWFJKZIUIATAL-CQSZACIVSA-N |
| XLogP | 3.83 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|