C21H20ClF2N3O3 — CID 58467513
2-[(3R)-4-(4-chloro-3,5-difluorophenyl)-3-methylpiperazin-1-yl]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide (PubChem CID 58467513) has the molecular formula C21H20ClF2N3O3 and a molecular weight of 435.86 g/mol. Its IUPAC name is 2-[(3R)-4-(4-chloro-3,5-difluorophenyl)-3-methylpiperazin-1-yl]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide.
| Compound Name | 2-[(3R)-4-(4-chloro-3,5-difluorophenyl)-3-methylpiperazin-1-yl]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide |
|---|---|
| PubChem CID | 58467513 |
| Molecular Formula | C21H20ClF2N3O3 |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 2-[(3R)-4-(4-chloro-3,5-difluorophenyl)-3-methylpiperazin-1-yl]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide |
| SMILES | C[C@@H]1CN(CC(=O)Nc2ccc3c(c2)OC(=O)C3)CCN1c1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C21H20ClF2N3O3/c1-12-10-26(4-5-27(12)15-8-16(23)21(22)17(24)9-15)11-19(28)25-14-3-2-13-6-20(29)30-18(13)7-14/h2-3,7-9,12H,4-6,10-11H2,1H3,(H,25,28)/t12-/m1/s1 |
| InChIKey | POEKRQAKJZLSCY-GFCCVEGCSA-N |
| XLogP | 3.23 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|