C22H21ClFN3O4 — CID 58467791
2-[(2R,5R)-4-(4-chloro-3-fluorophenyl)-2,5-dimethylpiperazin-1-yl]-2-oxo-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide (PubChem CID 58467791) has the molecular formula C22H21ClFN3O4 and a molecular weight of 445.88 g/mol. Its IUPAC name is 2-[(2R,5R)-4-(4-chloro-3-fluorophenyl)-2,5-dimethylpiperazin-1-yl]-2-oxo-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide.
| Compound Name | 2-[(2R,5R)-4-(4-chloro-3-fluorophenyl)-2,5-dimethylpiperazin-1-yl]-2-oxo-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide |
|---|---|
| PubChem CID | 58467791 |
| Molecular Formula | C22H21ClFN3O4 |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-[(2R,5R)-4-(4-chloro-3-fluorophenyl)-2,5-dimethylpiperazin-1-yl]-2-oxo-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide |
| SMILES | C[C@@H]1CN(c2ccc(Cl)c(F)c2)[C@H](C)CN1C(=O)C(=O)Nc1ccc2c(c1)OC(=O)C2 |
| InChI | InChI=1S/C22H21ClFN3O4/c1-12-11-27(13(2)10-26(12)16-5-6-17(23)18(24)9-16)22(30)21(29)25-15-4-3-14-7-20(28)31-19(14)8-15/h3-6,8-9,12-13H,7,10-11H2,1-2H3,(H,25,29)/t12-,13-/m1/s1 |
| InChIKey | MSWKAWJCCMRQKN-CHWSQXEVSA-N |
| XLogP | 3.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|