C22H18F4N2O3 — CID 58350760
2-fluoro-N-(2-oxo-3H-1-benzofuran-6-yl)-2-[1-[4-(trifluoromethyl)phenyl]piperidin-4-ylidene]acetamide (PubChem CID 58350760) has the molecular formula C22H18F4N2O3 and a molecular weight of 434.39 g/mol. Its IUPAC name is 2-fluoro-N-(2-oxo-3H-1-benzofuran-6-yl)-2-[1-[4-(trifluoromethyl)phenyl]piperidin-4-ylidene]acetamide.
| Compound Name | 2-fluoro-N-(2-oxo-3H-1-benzofuran-6-yl)-2-[1-[4-(trifluoromethyl)phenyl]piperidin-4-ylidene]acetamide |
|---|---|
| PubChem CID | 58350760 |
| Molecular Formula | C22H18F4N2O3 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2-fluoro-N-(2-oxo-3H-1-benzofuran-6-yl)-2-[1-[4-(trifluoromethyl)phenyl]piperidin-4-ylidene]acetamide |
| SMILES | O=C1Cc2ccc(NC(=O)C(F)=C3CCN(c4ccc(C(F)(F)F)cc4)CC3)cc2O1 |
| InChI | InChI=1S/C22H18F4N2O3/c23-20(21(30)27-16-4-1-14-11-19(29)31-18(14)12-16)13-7-9-28(10-8-13)17-5-2-15(3-6-17)22(24,25)26/h1-6,12H,7-11H2,(H,27,30) |
| InChIKey | BYKKKRSARNIHJA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|