C21H19F3N4O2 — CID 58350682
N-(3H-indol-6-yl)-2-oxo-2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide (PubChem CID 58350682) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is N-(3H-indol-6-yl)-2-oxo-2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3H-indol-6-yl)-2-oxo-2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 58350682 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-(3H-indol-6-yl)-2-oxo-2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
| SMILES | O=C(Nc1ccc2c(c1)N=CC2)C(=O)N1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H19F3N4O2/c22-21(23,24)15-2-5-17(6-3-15)27-9-11-28(12-10-27)20(30)19(29)26-16-4-1-14-7-8-25-18(14)13-16/h1-6,8,13H,7,9-12H2,(H,26,29) |
| InChIKey | RABOXKDQEQEJSX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|