C22H21F3N4O3 — CID 58467625
2-oxo-N-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide (PubChem CID 58467625) has the molecular formula C22H21F3N4O3 and a molecular weight of 446.43 g/mol. Its IUPAC name is 2-oxo-N-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide.
| Compound Name | 2-oxo-N-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 58467625 |
| Molecular Formula | C22H21F3N4O3 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-oxo-N-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
| SMILES | O=C1CCc2cc(NC(=O)C(=O)N3CCN(c4ccc(C(F)(F)F)cn4)CC3)ccc2C1 |
| InChI | InChI=1S/C22H21F3N4O3/c23-22(24,25)16-3-6-19(26-13-16)28-7-9-29(10-8-28)21(32)20(31)27-17-4-1-15-12-18(30)5-2-14(15)11-17/h1,3-4,6,11,13H,2,5,7-10,12H2,(H,27,31) |
| InChIKey | PFJVROVGFGSLEZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|