C22H20F2N2O4 — CID 58350730
2-[1-[4-(difluoromethoxy)phenyl]piperidin-4-ylidene]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide (PubChem CID 58350730) has the molecular formula C22H20F2N2O4 and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-[1-[4-(difluoromethoxy)phenyl]piperidin-4-ylidene]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide.
| Compound Name | 2-[1-[4-(difluoromethoxy)phenyl]piperidin-4-ylidene]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide |
|---|---|
| PubChem CID | 58350730 |
| Molecular Formula | C22H20F2N2O4 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-[1-[4-(difluoromethoxy)phenyl]piperidin-4-ylidene]-N-(2-oxo-3H-1-benzofuran-6-yl)acetamide |
| SMILES | O=C(C=C1CCN(c2ccc(OC(F)F)cc2)CC1)Nc1ccc2c(c1)OC(=O)C2 |
| InChI | InChI=1S/C22H20F2N2O4/c23-22(24)29-18-5-3-17(4-6-18)26-9-7-14(8-10-26)11-20(27)25-16-2-1-15-12-21(28)30-19(15)13-16/h1-6,11,13,22H,7-10,12H2,(H,25,27) |
| InChIKey | YFUVZXALVPCMAV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|