C21H20F2N2O4 — CID 58329010
6-[3-[4-(3,4-difluorophenyl)piperazin-1-yl]-3-oxopropoxy]-3H-1-benzofuran-2-one (PubChem CID 58329010) has the molecular formula C21H20F2N2O4 and a molecular weight of 402.40 g/mol. Its IUPAC name is 6-[3-[4-(3,4-difluorophenyl)piperazin-1-yl]-3-oxopropoxy]-3H-1-benzofuran-2-one.
| Compound Name | 6-[3-[4-(3,4-difluorophenyl)piperazin-1-yl]-3-oxopropoxy]-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 58329010 |
| Molecular Formula | C21H20F2N2O4 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 6-[3-[4-(3,4-difluorophenyl)piperazin-1-yl]-3-oxopropoxy]-3H-1-benzofuran-2-one |
| SMILES | O=C1Cc2ccc(OCCC(=O)N3CCN(c4ccc(F)c(F)c4)CC3)cc2O1 |
| InChI | InChI=1S/C21H20F2N2O4/c22-17-4-2-15(12-18(17)23)24-6-8-25(9-7-24)20(26)5-10-28-16-3-1-14-11-21(27)29-19(14)13-16/h1-4,12-13H,5-11H2 |
| InChIKey | CQPYKHHGEOWMLI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|