C21H25F2N3O2 — CID 55431470
2-[2-(4-fluorophenoxy)ethyl-methylamino]-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 55431470) has the molecular formula C21H25F2N3O2 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[2-(4-fluorophenoxy)ethyl-methylamino]-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[2-(4-fluorophenoxy)ethyl-methylamino]-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55431470 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[2-(4-fluorophenoxy)ethyl-methylamino]-1-[4-(4-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | CN(CCOc1ccc(F)cc1)CC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H25F2N3O2/c1-24(14-15-28-20-8-4-18(23)5-9-20)16-21(27)26-12-10-25(11-13-26)19-6-2-17(22)3-7-19/h2-9H,10-16H2,1H3 |
| InChIKey | YYUMOZVQAAAPPP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |