C22H27FN4O3 — CID 24507656
4-[2-[2-(4-fluorophenoxy)ethyl-methylamino]acetyl]-N-phenylpiperazine-1-carboxamide (PubChem CID 24507656) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-[2-[2-(4-fluorophenoxy)ethyl-methylamino]acetyl]-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[2-[2-(4-fluorophenoxy)ethyl-methylamino]acetyl]-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 24507656 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 4-[2-[2-(4-fluorophenoxy)ethyl-methylamino]acetyl]-N-phenylpiperazine-1-carboxamide |
| SMILES | CN(CCOc1ccc(F)cc1)CC(=O)N1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27FN4O3/c1-25(15-16-30-20-9-7-18(23)8-10-20)17-21(28)26-11-13-27(14-12-26)22(29)24-19-5-3-2-4-6-19/h2-10H,11-17H2,1H3,(H,24,29) |
| InChIKey | BLFLGKSHXAFZJC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |