C15H21BrFN3O2 — CID 120965945
2-[2-(3-bromo-5-fluorophenoxy)ethyl-methylamino]-1-piperazin-1-ylethanone (PubChem CID 120965945) has the molecular formula C15H21BrFN3O2 and a molecular weight of 374.25 g/mol. Its IUPAC name is 2-[2-(3-bromo-5-fluorophenoxy)ethyl-methylamino]-1-piperazin-1-ylethanone.
| Compound Name | 2-[2-(3-bromo-5-fluorophenoxy)ethyl-methylamino]-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 120965945 |
| Molecular Formula | C15H21BrFN3O2 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[2-(3-bromo-5-fluorophenoxy)ethyl-methylamino]-1-piperazin-1-ylethanone |
| SMILES | CN(CCOc1cc(F)cc(Br)c1)CC(=O)N1CCNCC1 |
| InChI | InChI=1S/C15H21BrFN3O2/c1-19(11-15(21)20-4-2-18-3-5-20)6-7-22-14-9-12(16)8-13(17)10-14/h8-10,18H,2-7,11H2,1H3 |
| InChIKey | CAKHKZGLCMGDHY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |